Talk:Methiodone: Difference between revisions
>Roshni No edit summary |
>Roshni m Roshni moved page Methiodone to Talk:Methiodone over redirect |
||
(4 intermediate revisions by the same user not shown) | |||
Line 2: | Line 2: | ||
| name = Methiodone | | name = Methiodone | ||
| image = Methiodone_structure.png | | image = Methiodone_structure.png | ||
| | | IUPAC_name = 6-(dimethylamino)-4,4-diphenylheptan-3-one methiodide | ||
| | | formula = C21H28INO | ||
| | | molar_mass = 437.36 g/mol | ||
| | | pubchem = | ||
| | | smiles = CN(C)CC(CC(C1=CC=CC=C1)(C2=CC=CC=C2)C(=O)C)C.[I-] | ||
| | | chemspiderid = | ||
| | | synonyms = IC-26 | ||
| | | legal_de = NpSG | ||
| | | legal_uk = PSA | ||
| legal_us = Unscheduled | |||
| routes_of_administration = Oral (presumed) | |||
}} | }} | ||
Line 55: | Line 57: | ||
[[Category:Synthetic substances]] | [[Category:Synthetic substances]] | ||
[[Category:Research chemicals]] | [[Category:Research chemicals]] | ||